C20H26N4O10 — CID 15984433
diethyl 2-[5-(4-ethoxycarbonylpiperazin-1-yl)-2,4-dinitrophenyl]propanedioate (PubChem CID 15984433) has the molecular formula C20H26N4O10 and a molecular weight of 482.45 g/mol. Its IUPAC name is diethyl 2-[5-(4-ethoxycarbonylpiperazin-1-yl)-2,4-dinitrophenyl]propanedioate.
| Compound Name | diethyl 2-[5-(4-ethoxycarbonylpiperazin-1-yl)-2,4-dinitrophenyl]propanedioate |
|---|---|
| PubChem CID | 15984433 |
| Molecular Formula | C20H26N4O10 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | diethyl 2-[5-(4-ethoxycarbonylpiperazin-1-yl)-2,4-dinitrophenyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cc(N2CCN(C(=O)OCC)CC2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N4O10/c1-4-32-18(25)17(19(26)33-5-2)13-11-15(16(24(30)31)12-14(13)23(28)29)21-7-9-22(10-8-21)20(27)34-6-3/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | JUVSOVSNSYQDLX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 171.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|