C22H26Br2N2O12 — CID 7158796
diethyl 2-[(R)-bromo-[5-[(1S)-1-bromo-3-ethoxy-2-ethoxycarbonyl-3-oxopropyl]-2,4-dinitrophenyl]methyl]propanedioate (PubChem CID 7158796) has the molecular formula C22H26Br2N2O12 and a molecular weight of 670.26 g/mol. Its IUPAC name is diethyl 2-[(R)-bromo-[5-[(1S)-1-bromo-3-ethoxy-2-ethoxycarbonyl-3-oxopropyl]-2,4-dinitrophenyl]methyl]propanedioate.
| Compound Name | diethyl 2-[(R)-bromo-[5-[(1S)-1-bromo-3-ethoxy-2-ethoxycarbonyl-3-oxopropyl]-2,4-dinitrophenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 7158796 |
| Molecular Formula | C22H26Br2N2O12 |
| Molecular Weight | 670.26 g/mol |
| Exact Mass | 667.99 |
| IUPAC Name | diethyl 2-[(R)-bromo-[5-[(1S)-1-bromo-3-ethoxy-2-ethoxycarbonyl-3-oxopropyl]-2,4-dinitrophenyl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](Br)c1cc([C@H](Br)C(C(=O)OCC)C(=O)OCC)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26Br2N2O12/c1-5-35-19(27)15(20(28)36-6-2)17(23)11-9-12(14(26(33)34)10-13(11)25(31)32)18(24)16(21(29)37-7-3)22(30)38-8-4/h9-10,15-18H,5-8H2,1-4H3/t17-,18+ |
| InChIKey | VGQOQMCXIUVLCR-HDICACEKSA-N |
| XLogP | 3.86 |
| TPSA | 191.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|