ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate

C11H10Br2ClNO4 — CID 172558148

IUPACethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate
SMILESCCOC(=O)C(Br)C(Br)c1cc(Cl)ccc1[N+](=O)[O-]
InChIInChI=1S/C11H10Br2ClNO4/c1-2-19-11(16)10(13)9(12)7-5-6(14)3-4-8(7)15(17)18/h3-5,9-10H,2H2,1H3
InChIKeyFTMPFPMOWREAID-UHFFFAOYSA-N
MW415.47 g/mol
LogP4.01
Rot. Bonds5

About ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate

ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate (PubChem CID 172558148) has the molecular formula C11H10Br2ClNO4 and a molecular weight of 415.47 g/mol. Its IUPAC name is ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate.

Molecular Properties

Compound Nameethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate
PubChem CID172558148
Molecular FormulaC11H10Br2ClNO4
Molecular Weight415.47 g/mol
Exact Mass412.87
IUPAC Nameethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate
SMILESCCOC(=O)C(Br)C(Br)c1cc(Cl)ccc1[N+](=O)[O-]
InChIInChI=1S/C11H10Br2ClNO4/c1-2-19-11(16)10(13)9(12)7-5-6(14)3-4-8(7)15(17)18/h3-5,9-10H,2H2,1H3
InChIKeyFTMPFPMOWREAID-UHFFFAOYSA-N
XLogP4.01
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500415.47
LogP ≤ 54.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate?
The IUPAC name of ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate (CID 172558148) is ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate.
What is the SMILES notation for ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate?
The canonical SMILES for ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate is CCOC(=O)C(Br)C(Br)c1cc(Cl)ccc1[N+](=O)[O-].
What is the InChIKey of ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate?
The InChIKey is FTMPFPMOWREAID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Br2ClNO4/c1-2-19-11(16)10(13)9(12)7-5-6(14)3-4-8(7)15(17)18/h3-5,9-10H,2H2,1H3.
What are the key properties of ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate?
ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate has a molecular weight of 415.47 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate is sourced from PubChem (CID 172558148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).