C11H10Br2ClNO4 — CID 172558148
ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate (PubChem CID 172558148) has the molecular formula C11H10Br2ClNO4 and a molecular weight of 415.47 g/mol. Its IUPAC name is ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate.
| Compound Name | ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 172558148 |
| Molecular Formula | C11H10Br2ClNO4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 412.87 |
| IUPAC Name | ethyl 2,3-dibromo-3-(5-chloro-2-nitrophenyl)propanoate |
| SMILES | CCOC(=O)C(Br)C(Br)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10Br2ClNO4/c1-2-19-11(16)10(13)9(12)7-5-6(14)3-4-8(7)15(17)18/h3-5,9-10H,2H2,1H3 |
| InChIKey | FTMPFPMOWREAID-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|