C22H34N4O6 — CID 59238189
tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-[(2-nitro-5-piperazin-1-ylbenzoyl)amino]propanoate (PubChem CID 59238189) has the molecular formula C22H34N4O6 and a molecular weight of 450.54 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-[(2-nitro-5-piperazin-1-ylbenzoyl)amino]propanoate.
| Compound Name | tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-[(2-nitro-5-piperazin-1-ylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 59238189 |
| Molecular Formula | C22H34N4O6 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-[(2-nitro-5-piperazin-1-ylbenzoyl)amino]propanoate |
| SMILES | CC(C)(C)OCC(NC(=O)c1cc(N2CCNCC2)ccc1[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H34N4O6/c1-21(2,3)31-14-17(20(28)32-22(4,5)6)24-19(27)16-13-15(7-8-18(16)26(29)30)25-11-9-23-10-12-25/h7-8,13,17,23H,9-12,14H2,1-6H3,(H,24,27) |
| InChIKey | MNSOUWGLPPZMHC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|