C27H40O6 — CID 11798209
3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]-1-[(4R,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propan-1-one (PubChem CID 11798209) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is 3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]-1-[(4R,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propan-1-one.
| Compound Name | 3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]-1-[(4R,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 11798209 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]-1-[(4R,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]propan-1-one |
| SMILES | C=CC[C@@H]1C[C@H](C(=O)CC[C@@H]2C[C@H](CCOCc3ccccc3)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C27H40O6/c1-6-10-21-18-25(33-27(4,5)30-21)24(28)14-13-22-17-23(32-26(2,3)31-22)15-16-29-19-20-11-8-7-9-12-20/h6-9,11-12,21-23,25H,1,10,13-19H2,2-5H3/t21-,22-,23+,25-/m1/s1 |
| InChIKey | CAPMVMIEVNFGMW-AGDMDRQQSA-N |
| XLogP | 5.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|