C26H32FNO7 — CID 11799229
ethyl 2-[3-(4-fluoro-3-nitrophenyl)propyl]-5-(4-methoxy-3-propan-2-yloxyphenyl)-3-oxopentanoate (PubChem CID 11799229) has the molecular formula C26H32FNO7 and a molecular weight of 489.54 g/mol. Its IUPAC name is ethyl 2-[3-(4-fluoro-3-nitrophenyl)propyl]-5-(4-methoxy-3-propan-2-yloxyphenyl)-3-oxopentanoate.
| Compound Name | ethyl 2-[3-(4-fluoro-3-nitrophenyl)propyl]-5-(4-methoxy-3-propan-2-yloxyphenyl)-3-oxopentanoate |
|---|---|
| PubChem CID | 11799229 |
| Molecular Formula | C26H32FNO7 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | ethyl 2-[3-(4-fluoro-3-nitrophenyl)propyl]-5-(4-methoxy-3-propan-2-yloxyphenyl)-3-oxopentanoate |
| SMILES | CCOC(=O)C(CCCc1ccc(F)c([N+](=O)[O-])c1)C(=O)CCc1ccc(OC)c(OC(C)C)c1 |
| InChI | InChI=1S/C26H32FNO7/c1-5-34-26(30)20(8-6-7-18-9-12-21(27)22(15-18)28(31)32)23(29)13-10-19-11-14-24(33-4)25(16-19)35-17(2)3/h9,11-12,14-17,20H,5-8,10,13H2,1-4H3 |
| InChIKey | PXZNPELBTKPDDH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|