C15H26N2O4 — CID 118000198
2,2,4-trimethyl-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]pentanoic acid (PubChem CID 118000198) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]pentanoic acid.
| Compound Name | 2,2,4-trimethyl-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 118000198 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2,2,4-trimethyl-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]pentanoic acid |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NC(C)(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C15H26N2O4/c1-8-10(18)16-15(6,7)11(19)17-14(4,5)9-13(2,3)12(20)21/h8H,1,9H2,2-7H3,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | JXNYTLSTXFOLHQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|