C13H23N3O4 — CID 134461784
2-amino-4-methyl-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]pentanoic acid (PubChem CID 134461784) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-amino-4-methyl-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]pentanoic acid.
| Compound Name | 2-amino-4-methyl-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 134461784 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-amino-4-methyl-4-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]pentanoic acid |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NC(C)(C)CC(N)C(=O)O |
| InChI | InChI=1S/C13H23N3O4/c1-6-9(17)15-13(4,5)11(20)16-12(2,3)7-8(14)10(18)19/h6,8H,1,7,14H2,2-5H3,(H,15,17)(H,16,20)(H,18,19) |
| InChIKey | DVTORCQRSFFACW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|