C24H29NO5 — CID 118001161
[2-methoxy-5-[(6-methoxy-2-propanoyl-3,4-dihydro-1H-isoquinolin-1-yl)methyl]phenyl] propanoate (PubChem CID 118001161) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is [2-methoxy-5-[(6-methoxy-2-propanoyl-3,4-dihydro-1H-isoquinolin-1-yl)methyl]phenyl] propanoate.
| Compound Name | [2-methoxy-5-[(6-methoxy-2-propanoyl-3,4-dihydro-1H-isoquinolin-1-yl)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 118001161 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [2-methoxy-5-[(6-methoxy-2-propanoyl-3,4-dihydro-1H-isoquinolin-1-yl)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(CC2c3ccc(OC)cc3CCN2C(=O)CC)ccc1OC |
| InChI | InChI=1S/C24H29NO5/c1-5-23(26)25-12-11-17-15-18(28-3)8-9-19(17)20(25)13-16-7-10-21(29-4)22(14-16)30-24(27)6-2/h7-10,14-15,20H,5-6,11-13H2,1-4H3 |
| InChIKey | DEYWAYYBKZCHON-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|