C30H29NO5 — CID 123217144
[5-[(2-benzoyl-6-methoxy-3,4-dihydro-1H-isoquinolin-1-yl)methyl]-2-methoxyphenyl] 2-methylidenebut-3-enoate (PubChem CID 123217144) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is [5-[(2-benzoyl-6-methoxy-3,4-dihydro-1H-isoquinolin-1-yl)methyl]-2-methoxyphenyl] 2-methylidenebut-3-enoate.
| Compound Name | [5-[(2-benzoyl-6-methoxy-3,4-dihydro-1H-isoquinolin-1-yl)methyl]-2-methoxyphenyl] 2-methylidenebut-3-enoate |
|---|---|
| PubChem CID | 123217144 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | [5-[(2-benzoyl-6-methoxy-3,4-dihydro-1H-isoquinolin-1-yl)methyl]-2-methoxyphenyl] 2-methylidenebut-3-enoate |
| SMILES | C=CC(=C)C(=O)Oc1cc(CC2c3ccc(OC)cc3CCN2C(=O)c2ccccc2)ccc1OC |
| InChI | InChI=1S/C30H29NO5/c1-5-20(2)30(33)36-28-18-21(11-14-27(28)35-4)17-26-25-13-12-24(34-3)19-23(25)15-16-31(26)29(32)22-9-7-6-8-10-22/h5-14,18-19,26H,1-2,15-17H2,3-4H3 |
| InChIKey | NVRJXRPVUILFJR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|