C19H19NO4 — CID 118001632
1-[(2E)-2-[(Z)-3-methoxyprop-1-enyl]penta-2,4-dienyl]-2-oxoquinoline-3-carboxylic acid (PubChem CID 118001632) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-[(2E)-2-[(Z)-3-methoxyprop-1-enyl]penta-2,4-dienyl]-2-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[(2E)-2-[(Z)-3-methoxyprop-1-enyl]penta-2,4-dienyl]-2-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 118001632 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[(2E)-2-[(Z)-3-methoxyprop-1-enyl]penta-2,4-dienyl]-2-oxoquinoline-3-carboxylic acid |
| SMILES | C=C/C=C(\C=C/COC)Cn1c(=O)c(C(=O)O)cc2ccccc21 |
| InChI | InChI=1S/C19H19NO4/c1-3-7-14(8-6-11-24-2)13-20-17-10-5-4-9-15(17)12-16(18(20)21)19(22)23/h3-10,12H,1,11,13H2,2H3,(H,22,23)/b8-6-,14-7+ |
| InChIKey | PPIAGZMDMYBYBN-VGVFFUEXSA-N |
| XLogP | 3.01 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|