About 3-octan-3-yloxyoctane;phosphoric acid
3-octan-3-yloxyoctane;phosphoric acid (PubChem CID 118002382) has the molecular formula C16H37O5P
and a molecular weight of 340.44 g/mol. Its IUPAC name is 3-octan-3-yloxyoctane;phosphoric acid.
Molecular Properties
| Compound Name | 3-octan-3-yloxyoctane;phosphoric acid |
| PubChem CID | 118002382 |
| Molecular Formula | C16H37O5P |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 3-octan-3-yloxyoctane;phosphoric acid |
| SMILES | CCCCCC(CC)OC(CC)CCCCC.O=P(O)(O)O |
| InChI | InChI=1S/C16H34O.H3O4P/c1-5-9-11-13-15(7-3)17-16(8-4)14-12-10-6-2;1-5(2,3)4/h15-16H,5-14H2,1-4H3;(H3,1,2,3,4) |
| InChIKey | WINNAQPPHLPJIC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-octan-3-yloxyoctane;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octan-3-yloxyoctane;phosphoric acid?
The IUPAC name of 3-octan-3-yloxyoctane;phosphoric acid (CID 118002382) is 3-octan-3-yloxyoctane;phosphoric acid.
What is the SMILES notation for 3-octan-3-yloxyoctane;phosphoric acid?
The canonical SMILES for 3-octan-3-yloxyoctane;phosphoric acid is CCCCCC(CC)OC(CC)CCCCC.O=P(O)(O)O.
What is the InChIKey of 3-octan-3-yloxyoctane;phosphoric acid?
The InChIKey is WINNAQPPHLPJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O.H3O4P/c1-5-9-11-13-15(7-3)17-16(8-4)14-12-10-6-2;1-5(2,3)4/h15-16H,5-14H2,1-4H3;(H3,1,2,3,4).
What are the key properties of 3-octan-3-yloxyoctane;phosphoric acid?
3-octan-3-yloxyoctane;phosphoric acid has a molecular weight of 340.44 g/mol, XLogP of 4.79, 12 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octan-3-yloxyoctane;phosphoric acid is sourced from PubChem (CID 118002382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).