About disodium;octan-3-yl phosphate
disodium;octan-3-yl phosphate (PubChem CID 87948378) has the molecular formula C8H17Na2O4P
and a molecular weight of 254.17 g/mol. Its IUPAC name is disodium;octan-3-yl phosphate.
Molecular Properties
| Compound Name | disodium;octan-3-yl phosphate |
| PubChem CID | 87948378 |
| Molecular Formula | C8H17Na2O4P |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | disodium;octan-3-yl phosphate |
| SMILES | CCCCCC(CC)OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H19O4P.2Na/c1-3-5-6-7-8(4-2)12-13(9,10)11;;/h8H,3-7H2,1-2H3,(H2,9,10,11);;/q;2*+1/p-2 |
| InChIKey | OLFPSRXCGLWANQ-UHFFFAOYSA-L |
| XLogP | -4.80 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;octan-3-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;octan-3-yl phosphate?
The IUPAC name of disodium;octan-3-yl phosphate (CID 87948378) is disodium;octan-3-yl phosphate.
What is the SMILES notation for disodium;octan-3-yl phosphate?
The canonical SMILES for disodium;octan-3-yl phosphate is CCCCCC(CC)OP(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;octan-3-yl phosphate?
The InChIKey is OLFPSRXCGLWANQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H19O4P.2Na/c1-3-5-6-7-8(4-2)12-13(9,10)11;;/h8H,3-7H2,1-2H3,(H2,9,10,11);;/q;2*+1/p-2.
What are the key properties of disodium;octan-3-yl phosphate?
disodium;octan-3-yl phosphate has a molecular weight of 254.17 g/mol, XLogP of -4.80, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;octan-3-yl phosphate is sourced from PubChem (CID 87948378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).