C27H55NO7P+ — CID 11800484
2-[[(2R)-3-[10-[(1S,2R)-2-hexylcyclopropyl]decanoyloxy]-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 11800484) has the molecular formula C27H55NO7P+ and a molecular weight of 536.71 g/mol. Its IUPAC name is 2-[[(2R)-3-[10-[(1S,2R)-2-hexylcyclopropyl]decanoyloxy]-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-3-[10-[(1S,2R)-2-hexylcyclopropyl]decanoyloxy]-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 11800484 |
| Molecular Formula | C27H55NO7P+ |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | 2-[[(2R)-3-[10-[(1S,2R)-2-hexylcyclopropyl]decanoyloxy]-2-hydroxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC[C@@H]1C[C@@H]1CCCCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C27H54NO7P/c1-5-6-7-13-16-24-21-25(24)17-14-11-9-8-10-12-15-18-27(30)33-22-26(29)23-35-36(31,32)34-20-19-28(2,3)4/h24-26,29H,5-23H2,1-4H3/p+1/t24-,25+,26-/m1/s1 |
| InChIKey | JMNXFZCXVGEDAC-UODIDJSMSA-O |
| XLogP | 5.85 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|