C10H8F3N3S — CID 118004983
2,7-dimethyl-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazine-6-thione (PubChem CID 118004983) has the molecular formula C10H8F3N3S and a molecular weight of 259.26 g/mol. Its IUPAC name is 2,7-dimethyl-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazine-6-thione.
| Compound Name | 2,7-dimethyl-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazine-6-thione |
|---|---|
| PubChem CID | 118004983 |
| Molecular Formula | C10H8F3N3S |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2,7-dimethyl-3-(trifluoromethyl)-5H-pyrido[2,3-b]pyrazine-6-thione |
| SMILES | Cc1nc2cc(C)c(=S)[nH]c2nc1C(F)(F)F |
| InChI | InChI=1S/C10H8F3N3S/c1-4-3-6-8(16-9(4)17)15-7(5(2)14-6)10(11,12)13/h3H,1-2H3,(H,15,16,17) |
| InChIKey | OYQXBIUDXXNQNX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|