C15H15N5O2 — CID 118005174
6-[(1-benzyltriazol-4-yl)methyl]-5-methyl-1H-pyrimidine-2,4-dione (PubChem CID 118005174) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 6-[(1-benzyltriazol-4-yl)methyl]-5-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(1-benzyltriazol-4-yl)methyl]-5-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118005174 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 6-[(1-benzyltriazol-4-yl)methyl]-5-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cc1c(Cc2cn(Cc3ccccc3)nn2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H15N5O2/c1-10-13(16-15(22)17-14(10)21)7-12-9-20(19-18-12)8-11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H2,16,17,21,22) |
| InChIKey | GLDGCOYWNROLSQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |