C13H11N5O2 — CID 118005393
1-methyl-5-(1-phenyltriazol-4-yl)pyrimidine-2,4-dione (PubChem CID 118005393) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-methyl-5-(1-phenyltriazol-4-yl)pyrimidine-2,4-dione.
| Compound Name | 1-methyl-5-(1-phenyltriazol-4-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118005393 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-methyl-5-(1-phenyltriazol-4-yl)pyrimidine-2,4-dione |
| SMILES | Cn1cc(-c2cn(-c3ccccc3)nn2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H11N5O2/c1-17-7-10(12(19)14-13(17)20)11-8-18(16-15-11)9-5-3-2-4-6-9/h2-8H,1H3,(H,14,19,20) |
| InChIKey | BLLXEVBNFUXAKB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |