C20H18N4O2 — CID 130228284
3-[1-[4-(2-hydroxypropan-2-yl)phenyl]triazol-4-yl]-1H-quinolin-2-one (PubChem CID 130228284) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[1-[4-(2-hydroxypropan-2-yl)phenyl]triazol-4-yl]-1H-quinolin-2-one.
| Compound Name | 3-[1-[4-(2-hydroxypropan-2-yl)phenyl]triazol-4-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 130228284 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-[1-[4-(2-hydroxypropan-2-yl)phenyl]triazol-4-yl]-1H-quinolin-2-one |
| SMILES | CC(C)(O)c1ccc(-n2cc(-c3cc4ccccc4[nH]c3=O)nn2)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-20(2,26)14-7-9-15(10-8-14)24-12-18(22-23-24)16-11-13-5-3-4-6-17(13)21-19(16)25/h3-12,26H,1-2H3,(H,21,25) |
| InChIKey | YFLQZWBKPPMPPB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |