C7H5FN4O2 — CID 118005417
6-fluoro-3-methyl-8H-pteridine-2,7-dione (PubChem CID 118005417) has the molecular formula C7H5FN4O2 and a molecular weight of 196.14 g/mol. Its IUPAC name is 6-fluoro-3-methyl-8H-pteridine-2,7-dione.
| Compound Name | 6-fluoro-3-methyl-8H-pteridine-2,7-dione |
|---|---|
| PubChem CID | 118005417 |
| Molecular Formula | C7H5FN4O2 |
| Molecular Weight | 196.14 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 6-fluoro-3-methyl-8H-pteridine-2,7-dione |
| SMILES | Cn1cc2nc(F)c(=O)[nH]c2nc1=O |
| InChI | InChI=1S/C7H5FN4O2/c1-12-2-3-5(11-7(12)14)10-6(13)4(8)9-3/h2H,1H3,(H,10,11,13,14) |
| InChIKey | MHPSUULISBWXMI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.14 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |