C36H35ClFN10O+ — CID 118007677
4-[2-[5-[4-amino-1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]piperidin-1-ium-1-yl]-3-(4-fluorophenyl)piperidin-2-yl]-1H-imidazol-5-yl]benzonitrile (PubChem CID 118007677) has the molecular formula C36H35ClFN10O+ and a molecular weight of 678.20 g/mol. Its IUPAC name is 4-[2-[5-[4-amino-1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]piperidin-1-ium-1-yl]-3-(4-fluorophenyl)piperidin-2-yl]-1H-imidazol-5-yl]benzonitrile.
| Compound Name | 4-[2-[5-[4-amino-1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]piperidin-1-ium-1-yl]-3-(4-fluorophenyl)piperidin-2-yl]-1H-imidazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 118007677 |
| Molecular Formula | C36H35ClFN10O+ |
| Molecular Weight | 678.20 g/mol |
| Exact Mass | 677.27 |
| IUPAC Name | 4-[2-[5-[4-amino-1-[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]piperidin-1-ium-1-yl]-3-(4-fluorophenyl)piperidin-2-yl]-1H-imidazol-5-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cnc(C3NCC([N+]4(C(=O)/C=C/c5cc(Cl)ccc5-n5cnnn5)CCC(N)CC4)CC3c3ccc(F)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C36H35ClFN10O/c37-27-8-11-33(47-22-43-45-46-47)26(17-27)7-12-34(49)48(15-13-29(40)14-16-48)30-18-31(24-5-9-28(38)10-6-24)35(41-20-30)36-42-21-32(44-36)25-3-1-23(19-39)2-4-25/h1-12,17,21-22,29-31,35,41H,13-16,18,20,40H2,(H,42,44)/q+1/b12-7+ |
| InChIKey | YVYAYCDHUXXYFK-KPKJPENVSA-N |
| XLogP | 5.08 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.20 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|