C18H17F4N3O — CID 118007851
N-[[4-[4-(difluoromethyl)phenyl]-5-fluoro-2-pyridinyl]methyl]-1-fluoropyrrolidine-2-carboxamide (PubChem CID 118007851) has the molecular formula C18H17F4N3O and a molecular weight of 367.35 g/mol. Its IUPAC name is N-[[4-[4-(difluoromethyl)phenyl]-5-fluoro-2-pyridinyl]methyl]-1-fluoropyrrolidine-2-carboxamide.
| Compound Name | N-[[4-[4-(difluoromethyl)phenyl]-5-fluoro-2-pyridinyl]methyl]-1-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118007851 |
| Molecular Formula | C18H17F4N3O |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[[4-[4-(difluoromethyl)phenyl]-5-fluoro-2-pyridinyl]methyl]-1-fluoropyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccc(C(F)F)cc2)c(F)cn1)C1CCCN1F |
| InChI | InChI=1S/C18H17F4N3O/c19-15-10-23-13(9-24-18(26)16-2-1-7-25(16)22)8-14(15)11-3-5-12(6-4-11)17(20)21/h3-6,8,10,16-17H,1-2,7,9H2,(H,24,26) |
| InChIKey | PIHKFEUDOQEEDH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|