C17H16BrF2N3O3S — CID 118007880
(2S,4R)-N-[(2-bromo-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 118007880) has the molecular formula C17H16BrF2N3O3S and a molecular weight of 460.30 g/mol. Its IUPAC name is (2S,4R)-N-[(2-bromo-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(2-bromo-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118007880 |
| Molecular Formula | C17H16BrF2N3O3S |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | (2S,4R)-N-[(2-bromo-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccnc(Br)c1)[C@@H]1C[C@@H](F)CN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16BrF2N3O3S/c18-16-7-11(5-6-21-16)9-22-17(24)15-8-13(20)10-23(15)27(25,26)14-3-1-12(19)2-4-14/h1-7,13,15H,8-10H2,(H,22,24)/t13-,15+/m1/s1 |
| InChIKey | BAWHCCGAFJHJOB-HIFRSBDPSA-N |
| XLogP | 2.40 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|