C17H15BrF3N3O3S — CID 122490112
(2S)-N-[(2-bromo-5-fluoro-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 122490112) has the molecular formula C17H15BrF3N3O3S and a molecular weight of 478.29 g/mol. Its IUPAC name is (2S)-N-[(2-bromo-5-fluoro-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2-bromo-5-fluoro-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 122490112 |
| Molecular Formula | C17H15BrF3N3O3S |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | (2S)-N-[(2-bromo-5-fluoro-4-pyridinyl)methyl]-4-fluoro-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1cc(Br)ncc1F)[C@@H]1CC(F)CN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15BrF3N3O3S/c18-16-5-10(14(21)8-22-16)7-23-17(25)15-6-12(20)9-24(15)28(26,27)13-3-1-11(19)2-4-13/h1-5,8,12,15H,6-7,9H2,(H,23,25)/t12?,15-/m0/s1 |
| InChIKey | XVEOMRBJEHFHQZ-CVRLYYSRSA-N |
| XLogP | 2.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|