C25H32FN3O2 — CID 118009312
4-(2-fluorophenyl)-4-[[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]cyclohexan-1-one (PubChem CID 118009312) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-4-[[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]cyclohexan-1-one.
| Compound Name | 4-(2-fluorophenyl)-4-[[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]cyclohexan-1-one |
|---|---|
| PubChem CID | 118009312 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 4-(2-fluorophenyl)-4-[[4-hydroxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]cyclohexan-1-one |
| SMILES | CN1CCN(Cc2cc(CNC3(c4ccccc4F)CCC(=O)CC3)ccc2O)CC1 |
| InChI | InChI=1S/C25H32FN3O2/c1-28-12-14-29(15-13-28)18-20-16-19(6-7-24(20)31)17-27-25(10-8-21(30)9-11-25)22-4-2-3-5-23(22)26/h2-7,16,27,31H,8-15,17-18H2,1H3 |
| InChIKey | ZFULYCMMRQVPDW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|