C27H23F5N6O2 — CID 118009825
3-[[3-methoxy-4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methoxy]phenyl]methyl]-6-(1-methylpyrazol-4-yl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 118009825) has the molecular formula C27H23F5N6O2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 3-[[3-methoxy-4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methoxy]phenyl]methyl]-6-(1-methylpyrazol-4-yl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-[[3-methoxy-4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methoxy]phenyl]methyl]-6-(1-methylpyrazol-4-yl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 118009825 |
| Molecular Formula | C27H23F5N6O2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 3-[[3-methoxy-4-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methoxy]phenyl]methyl]-6-(1-methylpyrazol-4-yl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | COc1cc(Cn2c(N)nc3cc(-c4cnn(C)c4)cnc32)ccc1OCc1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H23F5N6O2/c1-37-14-19(12-35-37)18-10-21-24(34-11-18)38(25(33)36-21)13-17-5-8-22(23(9-17)39-2)40-15-16-3-6-20(7-4-16)26(28,29)27(30,31)32/h3-12,14H,13,15H2,1-2H3,(H2,33,36) |
| InChIKey | DGQKIQCSFPDDDR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|