About 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine
2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine (PubChem CID 10542018) has the molecular formula C16H15N3O3
and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine |
| PubChem CID | 10542018 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine |
| SMILES | CCCOc1ccc2nc(-c3ccc4c(c3)OCO4)cn2n1 |
| InChI | InChI=1S/C16H15N3O3/c1-2-7-20-16-6-5-15-17-12(9-19(15)18-16)11-3-4-13-14(8-11)22-10-21-13/h3-6,8-9H,2,7,10H2,1H3 |
| InChIKey | XGKGLOKHXCXVPZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine (CID 10542018) is 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine is CCCOc1ccc2nc(-c3ccc4c(c3)OCO4)cn2n1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine?
The InChIKey is XGKGLOKHXCXVPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O3/c1-2-7-20-16-6-5-15-17-12(9-19(15)18-16)11-3-4-13-14(8-11)22-10-21-13/h3-6,8-9H,2,7,10H2,1H3.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine?
2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine has a molecular weight of 297.31 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-6-propoxyimidazo[1,2-b]pyridazine is sourced from PubChem (CID 10542018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).