C20H18Cl2N4O2S — CID 118010329
7-chloro-6-(4-chlorophenyl)-4-(4-ethenylsulfonylpiperazin-1-yl)quinazoline (PubChem CID 118010329) has the molecular formula C20H18Cl2N4O2S and a molecular weight of 449.36 g/mol. Its IUPAC name is 7-chloro-6-(4-chlorophenyl)-4-(4-ethenylsulfonylpiperazin-1-yl)quinazoline.
| Compound Name | 7-chloro-6-(4-chlorophenyl)-4-(4-ethenylsulfonylpiperazin-1-yl)quinazoline |
|---|---|
| PubChem CID | 118010329 |
| Molecular Formula | C20H18Cl2N4O2S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 7-chloro-6-(4-chlorophenyl)-4-(4-ethenylsulfonylpiperazin-1-yl)quinazoline |
| SMILES | C=CS(=O)(=O)N1CCN(c2ncnc3cc(Cl)c(-c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C20H18Cl2N4O2S/c1-2-29(27,28)26-9-7-25(8-10-26)20-17-11-16(14-3-5-15(21)6-4-14)18(22)12-19(17)23-13-24-20/h2-6,11-13H,1,7-10H2 |
| InChIKey | VUXXXBJEMCUMER-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |