C24H27Cl2N5 — CID 151167222
(E)-4-[4-[7-chloro-6-(4-chlorophenyl)quinazolin-4-yl]piperazin-1-yl]-N,N-dimethylbut-2-en-1-amine (PubChem CID 151167222) has the molecular formula C24H27Cl2N5 and a molecular weight of 456.42 g/mol. Its IUPAC name is (E)-4-[4-[7-chloro-6-(4-chlorophenyl)quinazolin-4-yl]piperazin-1-yl]-N,N-dimethylbut-2-en-1-amine.
| Compound Name | (E)-4-[4-[7-chloro-6-(4-chlorophenyl)quinazolin-4-yl]piperazin-1-yl]-N,N-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 151167222 |
| Molecular Formula | C24H27Cl2N5 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | (E)-4-[4-[7-chloro-6-(4-chlorophenyl)quinazolin-4-yl]piperazin-1-yl]-N,N-dimethylbut-2-en-1-amine |
| SMILES | CN(C)C/C=C/CN1CCN(c2ncnc3cc(Cl)c(-c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C24H27Cl2N5/c1-29(2)9-3-4-10-30-11-13-31(14-12-30)24-21-15-20(18-5-7-19(25)8-6-18)22(26)16-23(21)27-17-28-24/h3-8,15-17H,9-14H2,1-2H3/b4-3+ |
| InChIKey | NBNAQFALVAWKPC-ONEGZZNKSA-N |
| XLogP | 4.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|