C35H55NO3Si — CID 11801092
tert-butyl N-[(Z,3S)-1-[tert-butyl(diphenyl)silyl]oxytetradec-5-en-3-yl]carbamate (PubChem CID 11801092) has the molecular formula C35H55NO3Si and a molecular weight of 565.92 g/mol. Its IUPAC name is tert-butyl N-[(Z,3S)-1-[tert-butyl(diphenyl)silyl]oxytetradec-5-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(Z,3S)-1-[tert-butyl(diphenyl)silyl]oxytetradec-5-en-3-yl]carbamate |
|---|---|
| PubChem CID | 11801092 |
| Molecular Formula | C35H55NO3Si |
| Molecular Weight | 565.92 g/mol |
| Exact Mass | 565.40 |
| IUPAC Name | tert-butyl N-[(Z,3S)-1-[tert-butyl(diphenyl)silyl]oxytetradec-5-en-3-yl]carbamate |
| SMILES | CCCCCCCC/C=C\C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H55NO3Si/c1-8-9-10-11-12-13-14-15-18-23-30(36-33(37)39-34(2,3)4)28-29-38-40(35(5,6)7,31-24-19-16-20-25-31)32-26-21-17-22-27-32/h15-22,24-27,30H,8-14,23,28-29H2,1-7H3,(H,36,37)/b18-15-/t30-/m0/s1 |
| InChIKey | JTZVSQLVUXXOLU-DTZDQAFMSA-N |
| XLogP | 8.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.92 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|