C22H36FN4O9PS — CID 118012774
ethyl 2-[[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphinothioyl]amino]propanoate (PubChem CID 118012774) has the molecular formula C22H36FN4O9PS and a molecular weight of 582.59 g/mol. Its IUPAC name is ethyl 2-[[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphinothioyl]amino]propanoate.
| Compound Name | ethyl 2-[[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118012774 |
| Molecular Formula | C22H36FN4O9PS |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | ethyl 2-[[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphinothioyl]amino]propanoate |
| SMILES | C=C1NC(=O)C=CN1[C@@H]1O[C@](F)(COP(=S)(NC(C)C(=O)OCC)NC(C)C(=O)OC(C)C)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C22H36FN4O9PS/c1-8-33-17(29)13(4)25-37(38,26-14(5)18(30)35-12(2)3)34-11-22(23)19(31)21(7,32)20(36-22)27-10-9-16(28)24-15(27)6/h9-10,12-14,19-20,31-32H,6,8,11H2,1-5,7H3,(H,24,28)(H2,25,26,38)/t13?,14?,19-,20+,21+,22+,37?/m0/s1 |
| InChIKey | OFDWWFKSFKNMQU-SWGWXIIJSA-N |
| XLogP | 0.25 |
| TPSA | 167.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|