C29H52O4Sn — CID 11801403
dimethyl (4E)-3-(2,4-dimethylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 11801403) has the molecular formula C29H52O4Sn and a molecular weight of 583.44 g/mol. Its IUPAC name is dimethyl (4E)-3-(2,4-dimethylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-3-(2,4-dimethylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11801403 |
| Molecular Formula | C29H52O4Sn |
| Molecular Weight | 583.44 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | dimethyl (4E)-3-(2,4-dimethylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(C)CC(C)(C)C1CC(C(=O)OC)(C(=O)OC)C/C1=C\[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C17H25O4.3C4H9.Sn/c1-11(2)8-16(4,5)13-10-17(9-12(13)3,14(18)20-6)15(19)21-7;3*1-3-4-2;/h3,13H,1,8-10H2,2,4-7H3;3*1,3-4H2,2H3; |
| InChIKey | UVSBMOOXZIKSEZ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.44 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|