C12H25NO3 — CID 118014786
1,7-dimethoxy-5-(2-methoxyethyl)hept-4-en-3-amine (PubChem CID 118014786) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1,7-dimethoxy-5-(2-methoxyethyl)hept-4-en-3-amine.
| Compound Name | 1,7-dimethoxy-5-(2-methoxyethyl)hept-4-en-3-amine |
|---|---|
| PubChem CID | 118014786 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1,7-dimethoxy-5-(2-methoxyethyl)hept-4-en-3-amine |
| SMILES | COCCC(=CC(N)CCOC)CCOC |
| InChI | InChI=1S/C12H25NO3/c1-14-7-4-11(5-8-15-2)10-12(13)6-9-16-3/h10,12H,4-9,13H2,1-3H3 |
| InChIKey | AUCJTIIXTAJSFY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|