C9H19NO3 — CID 89256494
(E)-1,5,6-trimethoxyhex-4-en-3-amine (PubChem CID 89256494) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (E)-1,5,6-trimethoxyhex-4-en-3-amine.
| Compound Name | (E)-1,5,6-trimethoxyhex-4-en-3-amine |
|---|---|
| PubChem CID | 89256494 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (E)-1,5,6-trimethoxyhex-4-en-3-amine |
| SMILES | COCCC(N)/C=C(\COC)OC |
| InChI | InChI=1S/C9H19NO3/c1-11-5-4-8(10)6-9(13-3)7-12-2/h6,8H,4-5,7,10H2,1-3H3/b9-6+ |
| InChIKey | FZDBWJAFVNRRJK-RMKNXTFCSA-N |
| XLogP | 0.53 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|