C23H34N4O7 — CID 11801596
(2S)-2-[[(3S)-3-[[(2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-2-oxobutanoyl]amino]-4-methylpentanoic acid (PubChem CID 11801596) has the molecular formula C23H34N4O7 and a molecular weight of 478.55 g/mol. Its IUPAC name is (2S)-2-[[(3S)-3-[[(2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-2-oxobutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(3S)-3-[[(2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-2-oxobutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 11801596 |
| Molecular Formula | C23H34N4O7 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (2S)-2-[[(3S)-3-[[(2S)-5-amino-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-2-oxobutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)C(=O)[C@H](C)NC(=O)[C@H](CCCN)NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H34N4O7/c1-14(2)12-18(22(31)32)26-21(30)19(28)15(3)25-20(29)17(10-7-11-24)27-23(33)34-13-16-8-5-4-6-9-16/h4-6,8-9,14-15,17-18H,7,10-13,24H2,1-3H3,(H,25,29)(H,26,30)(H,27,33)(H,31,32)/t15-,17-,18-/m0/s1 |
| InChIKey | RJVCYZDEEYOPSV-SZMVWBNQSA-N |
| XLogP | 0.71 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|