C39H48O4 — CID 118016008
2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-9-[3-(4-methylphenyl)-2-oxopropyl]-7-propan-2-yl-5,6-dihydro-4H-tetracene-1,11-dione (PubChem CID 118016008) has the molecular formula C39H48O4 and a molecular weight of 580.81 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-9-[3-(4-methylphenyl)-2-oxopropyl]-7-propan-2-yl-5,6-dihydro-4H-tetracene-1,11-dione.
| Compound Name | 2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-9-[3-(4-methylphenyl)-2-oxopropyl]-7-propan-2-yl-5,6-dihydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118016008 |
| Molecular Formula | C39H48O4 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | 2-(1-hydroxyethyl)-3,4a,5a,10,12,12a-hexamethyl-9-[3-(4-methylphenyl)-2-oxopropyl]-7-propan-2-yl-5,6-dihydro-4H-tetracene-1,11-dione |
| SMILES | CC1=C(C(C)O)C(=O)C2(C)C(C)=C3C(=O)c4c(C)c(CC(=O)Cc5ccc(C)cc5)cc(C(C)C)c4CC3(C)CC2(C)C1 |
| InChI | InChI=1S/C39H48O4/c1-21(2)30-17-28(16-29(41)15-27-13-11-22(3)12-14-27)24(5)33-31(30)19-37(8)20-38(9)18-23(4)32(26(7)40)36(43)39(38,10)25(6)34(37)35(33)42/h11-14,17,21,26,40H,15-16,18-20H2,1-10H3 |
| InChIKey | OYLLVSZQHYODON-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |