C23H20ClN5O — CID 118019131
2-[2-[6-chloro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]phenyl]acetonitrile (PubChem CID 118019131) has the molecular formula C23H20ClN5O and a molecular weight of 417.90 g/mol. Its IUPAC name is 2-[2-[6-chloro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]phenyl]acetonitrile.
| Compound Name | 2-[2-[6-chloro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 118019131 |
| Molecular Formula | C23H20ClN5O |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[2-[6-chloro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]phenyl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2ncnc3cc(-c4ccccc4CC#N)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C23H20ClN5O/c1-2-22(30)28-9-11-29(12-10-28)23-19-13-20(24)18(14-21(19)26-15-27-23)17-6-4-3-5-16(17)7-8-25/h2-6,13-15H,1,7,9-12H2 |
| InChIKey | CCLFMWKMBLVHQE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|