C23H19Cl2N5O — CID 123258293
1-[4-[6-chloro-7-(2-chlorophenyl)quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 123258293) has the molecular formula C23H19Cl2N5O and a molecular weight of 452.35 g/mol. Its IUPAC name is 1-[4-[6-chloro-7-(2-chlorophenyl)quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[6-chloro-7-(2-chlorophenyl)quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123258293 |
| Molecular Formula | C23H19Cl2N5O |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 1-[4-[6-chloro-7-(2-chlorophenyl)quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]CC1CN(c2ncnc3cc(-c4ccccc4Cl)c(Cl)cc23)CCN1C(=O)C=C |
| InChI | InChI=1S/C23H19Cl2N5O/c1-3-22(31)30-9-8-29(13-15(30)12-26-2)23-18-10-20(25)17(11-21(18)27-14-28-23)16-6-4-5-7-19(16)24/h3-7,10-11,14-15H,1,8-9,12-13H2 |
| InChIKey | VKSKHFOHXJKPSQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|