C24H25ClN6O2 — CID 146551270
N-(2-aminoethyl)-4-(6-chloro-7-phenylquinazolin-4-yl)-1-prop-2-enoylpiperazine-2-carboxamide (PubChem CID 146551270) has the molecular formula C24H25ClN6O2 and a molecular weight of 464.96 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-(6-chloro-7-phenylquinazolin-4-yl)-1-prop-2-enoylpiperazine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-4-(6-chloro-7-phenylquinazolin-4-yl)-1-prop-2-enoylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 146551270 |
| Molecular Formula | C24H25ClN6O2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-(2-aminoethyl)-4-(6-chloro-7-phenylquinazolin-4-yl)-1-prop-2-enoylpiperazine-2-carboxamide |
| SMILES | C=CC(=O)N1CCN(c2ncnc3cc(-c4ccccc4)c(Cl)cc23)CC1C(=O)NCCN |
| InChI | InChI=1S/C24H25ClN6O2/c1-2-22(32)31-11-10-30(14-21(31)24(33)27-9-8-26)23-18-12-19(25)17(13-20(18)28-15-29-23)16-6-4-3-5-7-16/h2-7,12-13,15,21H,1,8-11,14,26H2,(H,27,33) |
| InChIKey | NEWXGZMTKVNCRO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|