C17H13ClN6O — CID 123926288
1-[4-(7-chloro-6-isocyanoquinazolin-4-yl)-2-isocyanopiperazin-1-yl]prop-2-en-1-one (PubChem CID 123926288) has the molecular formula C17H13ClN6O and a molecular weight of 352.79 g/mol. Its IUPAC name is 1-[4-(7-chloro-6-isocyanoquinazolin-4-yl)-2-isocyanopiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(7-chloro-6-isocyanoquinazolin-4-yl)-2-isocyanopiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123926288 |
| Molecular Formula | C17H13ClN6O |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-[4-(7-chloro-6-isocyanoquinazolin-4-yl)-2-isocyanopiperazin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]c1cc2c(N3CCN(C(=O)C=C)C([N+]#[C-])C3)ncnc2cc1Cl |
| InChI | InChI=1S/C17H13ClN6O/c1-4-16(25)24-6-5-23(9-15(24)20-3)17-11-7-14(19-2)12(18)8-13(11)21-10-22-17/h4,7-8,10,15H,1,5-6,9H2 |
| InChIKey | YMWMFGPLKDDCIY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|