C12H12F5N3O3 — CID 118019274
4-hydroxy-1-methoxy-5-methyl-3-[4-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]imidazolidin-2-one (PubChem CID 118019274) has the molecular formula C12H12F5N3O3 and a molecular weight of 341.24 g/mol. Its IUPAC name is 4-hydroxy-1-methoxy-5-methyl-3-[4-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]imidazolidin-2-one.
| Compound Name | 4-hydroxy-1-methoxy-5-methyl-3-[4-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 118019274 |
| Molecular Formula | C12H12F5N3O3 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 4-hydroxy-1-methoxy-5-methyl-3-[4-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]imidazolidin-2-one |
| SMILES | CON1C(=O)N(c2cc(C(F)(F)C(F)(F)F)ccn2)C(O)C1C |
| InChI | InChI=1S/C12H12F5N3O3/c1-6-9(21)19(10(22)20(6)23-2)8-5-7(3-4-18-8)11(13,14)12(15,16)17/h3-6,9,21H,1-2H3 |
| InChIKey | WBSKOCFIKUEGCG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|