C17H22F3N3O6 — CID 155073765
(4R)-1-methyl-3-[4-(trifluoromethyl)-2-pyridinyl]-4-[(1S,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyimidazolidin-2-one (PubChem CID 155073765) has the molecular formula C17H22F3N3O6 and a molecular weight of 421.37 g/mol. Its IUPAC name is (4R)-1-methyl-3-[4-(trifluoromethyl)-2-pyridinyl]-4-[(1S,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyimidazolidin-2-one.
| Compound Name | (4R)-1-methyl-3-[4-(trifluoromethyl)-2-pyridinyl]-4-[(1S,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyimidazolidin-2-one |
|---|---|
| PubChem CID | 155073765 |
| Molecular Formula | C17H22F3N3O6 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (4R)-1-methyl-3-[4-(trifluoromethyl)-2-pyridinyl]-4-[(1S,2R,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyimidazolidin-2-one |
| SMILES | CN1C[C@@H](O[C@H]2C[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)N(c2cc(C(F)(F)F)ccn2)C1=O |
| InChI | InChI=1S/C17H22F3N3O6/c1-22-6-12(29-10-4-8(7-24)13(25)15(27)14(10)26)23(16(22)28)11-5-9(2-3-21-11)17(18,19)20/h2-3,5,8,10,12-15,24-27H,4,6-7H2,1H3/t8-,10+,12-,13-,14+,15+/m1/s1 |
| InChIKey | LOJOVUXZPFZRHG-UHIWYIMESA-N |
| XLogP | -0.22 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |