C13H15F3N2O2 — CID 126954982
1-methyl-5-[[4-(trifluoromethyl)-2-pyridinyl]oxymethyl]piperidin-2-one (PubChem CID 126954982) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-methyl-5-[[4-(trifluoromethyl)-2-pyridinyl]oxymethyl]piperidin-2-one.
| Compound Name | 1-methyl-5-[[4-(trifluoromethyl)-2-pyridinyl]oxymethyl]piperidin-2-one |
|---|---|
| PubChem CID | 126954982 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-methyl-5-[[4-(trifluoromethyl)-2-pyridinyl]oxymethyl]piperidin-2-one |
| SMILES | CN1CC(COc2cc(C(F)(F)F)ccn2)CCC1=O |
| InChI | InChI=1S/C13H15F3N2O2/c1-18-7-9(2-3-12(18)19)8-20-11-6-10(4-5-17-11)13(14,15)16/h4-6,9H,2-3,7-8H2,1H3 |
| InChIKey | BIOGDYSAIFTSJJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |