C30H42N2O7S — CID 118020917
3-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)butyl-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid (PubChem CID 118020917) has the molecular formula C30H42N2O7S and a molecular weight of 574.74 g/mol. Its IUPAC name is 3-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)butyl-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)butyl-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 118020917 |
| Molecular Formula | C30H42N2O7S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 3-[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)butyl-(4-methylcyclohexanecarbonyl)amino]-5-(3,3-dimethylbut-1-ynyl)thiophene-2-carboxylic acid |
| SMILES | CC1CCC(C(=O)N(CCC(C)NC(=O)OC2COC3OCCC23)c2cc(C#CC(C)(C)C)sc2C(=O)O)CC1 |
| InChI | InChI=1S/C30H42N2O7S/c1-18-6-8-20(9-7-18)26(33)32(23-16-21(10-13-30(3,4)5)40-25(23)27(34)35)14-11-19(2)31-29(36)39-24-17-38-28-22(24)12-15-37-28/h16,18-20,22,24,28H,6-9,11-12,14-15,17H2,1-5H3,(H,31,36)(H,34,35) |
| InChIKey | NYYQNAURXBVXCL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|