C10H14ClFN2 — CID 118021340
1-(4-chloro-3-fluorophenyl)-N'-methylpropane-1,3-diamine (PubChem CID 118021340) has the molecular formula C10H14ClFN2 and a molecular weight of 216.69 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-N'-methylpropane-1,3-diamine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 118021340 |
| Molecular Formula | C10H14ClFN2 |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-N'-methylpropane-1,3-diamine |
| SMILES | CNCCC(N)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H14ClFN2/c1-14-5-4-10(13)7-2-3-8(11)9(12)6-7/h2-3,6,10,14H,4-5,13H2,1H3 |
| InChIKey | WKRXWHVBKBNYRL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |