C27H23Cl3N2O — CID 118022884
(3-chlorophenyl)-(2,4-dichloro-3-cyclohexylquinolin-6-yl)-pyridin-3-ylmethanol (PubChem CID 118022884) has the molecular formula C27H23Cl3N2O and a molecular weight of 497.85 g/mol. Its IUPAC name is (3-chlorophenyl)-(2,4-dichloro-3-cyclohexylquinolin-6-yl)-pyridin-3-ylmethanol.
| Compound Name | (3-chlorophenyl)-(2,4-dichloro-3-cyclohexylquinolin-6-yl)-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 118022884 |
| Molecular Formula | C27H23Cl3N2O |
| Molecular Weight | 497.85 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | (3-chlorophenyl)-(2,4-dichloro-3-cyclohexylquinolin-6-yl)-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)(c1cccc(Cl)c1)c1ccc2nc(Cl)c(C3CCCCC3)c(Cl)c2c1 |
| InChI | InChI=1S/C27H23Cl3N2O/c28-21-10-4-8-18(14-21)27(33,20-9-5-13-31-16-20)19-11-12-23-22(15-19)25(29)24(26(30)32-23)17-6-2-1-3-7-17/h4-5,8-17,33H,1-3,6-7H2 |
| InChIKey | PCTSOYJPBCHEKR-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.85 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|