C28H30N2O — CID 20814950
2-methyl-4-[3-(6-propan-2-ylquinolin-8-yl)phenyl]-3-pyridin-4-ylbutan-2-ol (PubChem CID 20814950) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-methyl-4-[3-(6-propan-2-ylquinolin-8-yl)phenyl]-3-pyridin-4-ylbutan-2-ol.
| Compound Name | 2-methyl-4-[3-(6-propan-2-ylquinolin-8-yl)phenyl]-3-pyridin-4-ylbutan-2-ol |
|---|---|
| PubChem CID | 20814950 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 2-methyl-4-[3-(6-propan-2-ylquinolin-8-yl)phenyl]-3-pyridin-4-ylbutan-2-ol |
| SMILES | CC(C)c1cc(-c2cccc(CC(c3ccncc3)C(C)(C)O)c2)c2ncccc2c1 |
| InChI | InChI=1S/C28H30N2O/c1-19(2)24-17-23-9-6-12-30-27(23)25(18-24)22-8-5-7-20(15-22)16-26(28(3,4)31)21-10-13-29-14-11-21/h5-15,17-19,26,31H,16H2,1-4H3 |
| InChIKey | AGNPWVFAZVESPJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |