C28H30N2O2 — CID 22350058
2-methyl-3-(1-oxidopyridin-1-ium-4-yl)-4-[3-(6-propan-2-ylquinolin-8-yl)phenyl]butan-2-ol (PubChem CID 22350058) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-methyl-3-(1-oxidopyridin-1-ium-4-yl)-4-[3-(6-propan-2-ylquinolin-8-yl)phenyl]butan-2-ol.
| Compound Name | 2-methyl-3-(1-oxidopyridin-1-ium-4-yl)-4-[3-(6-propan-2-ylquinolin-8-yl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 22350058 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 2-methyl-3-(1-oxidopyridin-1-ium-4-yl)-4-[3-(6-propan-2-ylquinolin-8-yl)phenyl]butan-2-ol |
| SMILES | CC(C)c1cc(-c2cccc(CC(c3cc[n+]([O-])cc3)C(C)(C)O)c2)c2ncccc2c1 |
| InChI | InChI=1S/C28H30N2O2/c1-19(2)24-17-23-9-6-12-29-27(23)25(18-24)22-8-5-7-20(15-22)16-26(28(3,4)31)21-10-13-30(32)14-11-21/h5-15,17-19,26,31H,16H2,1-4H3 |
| InChIKey | AXCRMUXYGSQLGD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|