C30H36N2O2 — CID 142200040
(E)-4-[(Z)-2-aminoethenyl]-2-methyl-3-[[3-(6-propan-2-ylquinolin-8-yl)phenyl]methyl]hept-4-en-6-yn-2-ol;methanol (PubChem CID 142200040) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is (E)-4-[(Z)-2-aminoethenyl]-2-methyl-3-[[3-(6-propan-2-ylquinolin-8-yl)phenyl]methyl]hept-4-en-6-yn-2-ol;methanol.
| Compound Name | (E)-4-[(Z)-2-aminoethenyl]-2-methyl-3-[[3-(6-propan-2-ylquinolin-8-yl)phenyl]methyl]hept-4-en-6-yn-2-ol;methanol |
|---|---|
| PubChem CID | 142200040 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | (E)-4-[(Z)-2-aminoethenyl]-2-methyl-3-[[3-(6-propan-2-ylquinolin-8-yl)phenyl]methyl]hept-4-en-6-yn-2-ol;methanol |
| SMILES | C#C/C=C(\C=C/N)C(Cc1cccc(-c2cc(C(C)C)cc3cccnc23)c1)C(C)(C)O.CO |
| InChI | InChI=1S/C29H32N2O.CH4O/c1-6-9-22(13-14-30)27(29(4,5)32)17-21-10-7-11-23(16-21)26-19-25(20(2)3)18-24-12-8-15-31-28(24)26;1-2/h1,7-16,18-20,27,32H,17,30H2,2-5H3;2H,1H3/b14-13-,22-9+; |
| InChIKey | PBSAJQOFQGEMNW-BBKKOFGESA-N |
| XLogP | 5.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|