C27H29NO2S — CID 10288042
hydroxy-dimethyl-[4-[[3-(6-propan-2-ylquinolin-8-yl)phenyl]methoxy]phenyl]-λ4-sulfane (PubChem CID 10288042) has the molecular formula C27H29NO2S and a molecular weight of 431.60 g/mol. Its IUPAC name is hydroxy-dimethyl-[4-[[3-(6-propan-2-ylquinolin-8-yl)phenyl]methoxy]phenyl]-λ4-sulfane.
| Compound Name | hydroxy-dimethyl-[4-[[3-(6-propan-2-ylquinolin-8-yl)phenyl]methoxy]phenyl]-λ4-sulfane |
|---|---|
| PubChem CID | 10288042 |
| Molecular Formula | C27H29NO2S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | hydroxy-dimethyl-[4-[[3-(6-propan-2-ylquinolin-8-yl)phenyl]methoxy]phenyl]-λ4-sulfane |
| SMILES | CC(C)c1cc(-c2cccc(COc3ccc(S(C)(C)O)cc3)c2)c2ncccc2c1 |
| InChI | InChI=1S/C27H29NO2S/c1-19(2)23-16-22-9-6-14-28-27(22)26(17-23)21-8-5-7-20(15-21)18-30-24-10-12-25(13-11-24)31(3,4)29/h5-17,19,29H,18H2,1-4H3 |
| InChIKey | FTDQIIPLYCRZGP-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |