C10H8ClNO4S — CID 118025249
(3-chlorophenyl)-(1,3-oxazol-5-yl)methanesulfonic acid (PubChem CID 118025249) has the molecular formula C10H8ClNO4S and a molecular weight of 273.70 g/mol. Its IUPAC name is (3-chlorophenyl)-(1,3-oxazol-5-yl)methanesulfonic acid.
| Compound Name | (3-chlorophenyl)-(1,3-oxazol-5-yl)methanesulfonic acid |
|---|---|
| PubChem CID | 118025249 |
| Molecular Formula | C10H8ClNO4S |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | (3-chlorophenyl)-(1,3-oxazol-5-yl)methanesulfonic acid |
| SMILES | O=S(=O)(O)C(c1cccc(Cl)c1)c1cnco1 |
| InChI | InChI=1S/C10H8ClNO4S/c11-8-3-1-2-7(4-8)10(17(13,14)15)9-5-12-6-16-9/h1-6,10H,(H,13,14,15) |
| InChIKey | IUBYSOXCYHJHBO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|